What is the structural formula of 4-Ethyl-2 hexene?
(E)-4-Ethylhex-2-ene | C8H16 | ChemSpider.
What is the structural formula of 4-Ethyl-2 2-Dimethylhexane?
Hexane, 4-ethyl-2,2-dimethyl-
| PubChem CID | 142982 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C10H22 |
| Synonyms | 4-Ethyl-2,2-dimethylhexane Hexane, 4-ethyl-2,2-dimethyl- 52896-99-8 2,2-dimethyl-4-ethylhexane DTXSID30200935 More… |
| Molecular Weight | 142.28 |
What is the condensed formula for 4-ethyl-2 hexene?
C8H16
Compound with free spectra: 1 NMR, and 2 FTIR
| SpectraBase Compound ID | JkWnRZmBKZJ |
|---|---|
| InChI | InChI=1S/C8H16/c1-4-7-8(5-2)6-3/h4,7-8H,5-6H2,1-3H3/b7-4+ |
| InChIKey | STHONQMAWQLWLX-QPJJXVBHSA-N |
| Mol Weight | 112.22 g/mol |
| Molecular Formula | C8H16 |
What is the condensed formula of 4-Ethyl-2 Methylhexane?
Identification of 4-Ethyl-2-methylhexane Chemical Compound
| Chemical Formula | C9H20 |
|---|---|
| Molecular Weight | 128.2551 g/mol |
| IUPAC Name | 4-ethyl-2-methylhexane |
| SMILES String | CCC(CC)CC(C)C |
| InChI | InChI=1S/C9H20/c1-5-9(6-2)7-8(3)4/h8-9H,5-7H2,1-4H3 |
What is the structural formula of hexene 2?
2-Hexene
| PubChem CID | 19966 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H12 |
| Synonyms | 2-HEXENE 2-hexene, (2Z)- 2-Hexene,c&t 592-43-8 Methylpentaene More… |
| Molecular Weight | 84.16 |
What is the structural formula of 4-Ethyl-2 3-Dimethylhexane?
C10H22
4-Ethyl-2,3-dimethylhexane | C10H22 | ChemSpider.
What is the structural formula of 4-Ethyl-2 2 3 Trimethylhexane?
4-ethyl-2,3,3-trimethylhexane
| Common Name | 4-ethyl-2,3,3-trimethylhexane | |
|---|---|---|
| CAS Number | 61868-78-8 | Molecular Weight |
| Density | N/A | Boiling Point |
| Molecular Formula | C11H24 | Melting Point |
| MSDS | N/A | Flash Point |
What is the condensed structural formula of 2 Methylhexane?
2-Methylhexane
| PubChem CID | 11582 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C7H16 or CH3CH(CH3)(CH2)3CH3 |
| Synonyms | 2-METHYLHEXANE 591-76-4 Hexane, 2-methyl- ISOHEPTANE UNII-YI4679P2SP More… |
| Molecular Weight | 100.20 |
What is the structural formula of 2 Methyl 2-hexene?
C7H14
2-Methyl-2-hexene 97.0+%, TCI America
| CAS | 2738-19-4 |
|---|---|
| Molecular Formula | C7H14 |
| Molecular Weight (g/mol) | 98.189 |
| MDL Number | MFCD00027232 |
| InChI Key | BWEKDYGHDCHWEN-UHFFFAOYSA-N |
What is the formula of hexene?
C6H121-Hexene / Formula